![[ICO]](/icons/blank.gif){kind=icon}
![[DIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| ACH ugrad research - Structural Dynamics of HokieSat.doc | 14-Mar-2002 12:06 | 428K | |
| AFRL Satellite Fab Course/ | 14-Mar-2002 12:06 | - | |
| BJN_AAS_Ponce.ppt | 29-May-2003 10:10 | 3.7M | |
| CLS Quebec City presentation - System ID of Nanosatellite Structure.ppt | 14-Mar-2002 12:07 | 7.8M | |
| CLS_Defense_05_28_02.ppt | 28-Aug-2002 13:09 | 13M | |
| HokieSat ICDs/ | 14-Mar-2002 12:07 | - | |
| ION-F Papers/ | 22-Apr-2002 14:52 | - | |
| JDJ SmallSat paper - Command and Data Handling Subsystem Design for the Ionospheric Observation Nanosatellite Formation (ION-F).doc | 14-Mar-2002 12:08 | 512K | |
| KLM MS thesis - A Nonlinear Magnetic Controller for Three-Axis Stability of Nanosatellites.pdf | 14-Mar-2002 12:08 | 2.7M | |
| NASA and MIL documents/ | 14-Mar-2002 12:09 | - | |
| Pedraza_Astrium_020906.ppt | 06-Sep-2002 08:24 | 8.8M | |
| Trip Reports/ | 14-Mar-2002 12:09 | - | |
| slides for Chuck.ppt | 09-Aug-2002 12:53 | 3.9M | |